C26H48N2O6Si2 — CID 22247245
N-(3-triethoxysilylpropyl)-1-[4-(3-triethoxysilylpropyliminomethyl)phenyl]methanimine (PubChem CID 22247245) has the molecular formula C26H48N2O6Si2 and a molecular weight of 540.85 g/mol. Its IUPAC name is N-(3-triethoxysilylpropyl)-1-[4-(3-triethoxysilylpropyliminomethyl)phenyl]methanimine.
| Compound Name | N-(3-triethoxysilylpropyl)-1-[4-(3-triethoxysilylpropyliminomethyl)phenyl]methanimine |
|---|---|
| PubChem CID | 22247245 |
| Molecular Formula | C26H48N2O6Si2 |
| Molecular Weight | 540.85 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | N-(3-triethoxysilylpropyl)-1-[4-(3-triethoxysilylpropyliminomethyl)phenyl]methanimine |
| SMILES | CCO[Si](CCC/N=C/c1ccc(/C=N/CCC[Si](OCC)(OCC)OCC)cc1)(OCC)OCC |
| InChI | InChI=1S/C26H48N2O6Si2/c1-7-29-35(30-8-2,31-9-3)21-13-19-27-23-25-15-17-26(18-16-25)24-28-20-14-22-36(32-10-4,33-11-5)34-12-6/h15-18,23-24H,7-14,19-22H2,1-6H3/b27-23+,28-24+ |
| InChIKey | ISEQPCJEDJEDHD-LMCGJEQXSA-N |
| XLogP | 5.40 |
| TPSA | 80.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.85 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|