C12H19NO4Si — CID 139211804
2-[3-[ethoxy(dihydroxy)silyl]propyliminomethyl]phenol (PubChem CID 139211804) has the molecular formula C12H19NO4Si and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-[3-[ethoxy(dihydroxy)silyl]propyliminomethyl]phenol.
| Compound Name | 2-[3-[ethoxy(dihydroxy)silyl]propyliminomethyl]phenol |
|---|---|
| PubChem CID | 139211804 |
| Molecular Formula | C12H19NO4Si |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-[3-[ethoxy(dihydroxy)silyl]propyliminomethyl]phenol |
| SMILES | CCO[Si](O)(O)CCC/N=C/c1ccccc1O |
| InChI | InChI=1S/C12H19NO4Si/c1-2-17-18(15,16)9-5-8-13-10-11-6-3-4-7-12(11)14/h3-4,6-7,10,14-16H,2,5,8-9H2,1H3/b13-10+ |
| InChIKey | WBPPBUWPPQSULD-JLHYYAGUSA-N |
| XLogP | 1.16 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|