C18H29NO3Si — CID 71347976
1-(4-ethenylphenyl)-N-(3-triethoxysilylpropyl)methanimine (PubChem CID 71347976) has the molecular formula C18H29NO3Si and a molecular weight of 335.52 g/mol. Its IUPAC name is 1-(4-ethenylphenyl)-N-(3-triethoxysilylpropyl)methanimine.
| Compound Name | 1-(4-ethenylphenyl)-N-(3-triethoxysilylpropyl)methanimine |
|---|---|
| PubChem CID | 71347976 |
| Molecular Formula | C18H29NO3Si |
| Molecular Weight | 335.52 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1-(4-ethenylphenyl)-N-(3-triethoxysilylpropyl)methanimine |
| SMILES | C=Cc1ccc(/C=N/CCC[Si](OCC)(OCC)OCC)cc1 |
| InChI | InChI=1S/C18H29NO3Si/c1-5-17-10-12-18(13-11-17)16-19-14-9-15-23(20-6-2,21-7-3)22-8-4/h5,10-13,16H,1,6-9,14-15H2,2-4H3/b19-16+ |
| InChIKey | RHTMGJXYNFZCKV-KNTRCKAVSA-N |
| XLogP | 4.19 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|