About acetonitrile;triethoxy(3-isocyanatopropyl)silane
acetonitrile;triethoxy(3-isocyanatopropyl)silane (PubChem CID 158725312) has the molecular formula C12H24N2O4Si
and a molecular weight of 288.42 g/mol. Its IUPAC name is acetonitrile;triethoxy(3-isocyanatopropyl)silane.
Molecular Properties
| Compound Name | acetonitrile;triethoxy(3-isocyanatopropyl)silane |
| PubChem CID | 158725312 |
| Molecular Formula | C12H24N2O4Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | acetonitrile;triethoxy(3-isocyanatopropyl)silane |
| SMILES | CC#N.CCO[Si](CCCN=C=O)(OCC)OCC |
| InChI | InChI=1S/C10H21NO4Si.C2H3N/c1-4-13-16(14-5-2,15-6-3)9-7-8-11-10-12;1-2-3/h4-9H2,1-3H3;1H3 |
| InChIKey | IKKRYGBOXBFTKY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 80.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;triethoxy(3-isocyanatopropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;triethoxy(3-isocyanatopropyl)silane?
The IUPAC name of acetonitrile;triethoxy(3-isocyanatopropyl)silane (CID 158725312) is acetonitrile;triethoxy(3-isocyanatopropyl)silane.
What is the SMILES notation for acetonitrile;triethoxy(3-isocyanatopropyl)silane?
The canonical SMILES for acetonitrile;triethoxy(3-isocyanatopropyl)silane is CC#N.CCO[Si](CCCN=C=O)(OCC)OCC.
What is the InChIKey of acetonitrile;triethoxy(3-isocyanatopropyl)silane?
The InChIKey is IKKRYGBOXBFTKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO4Si.C2H3N/c1-4-13-16(14-5-2,15-6-3)9-7-8-11-10-12;1-2-3/h4-9H2,1-3H3;1H3.
What are the key properties of acetonitrile;triethoxy(3-isocyanatopropyl)silane?
acetonitrile;triethoxy(3-isocyanatopropyl)silane has a molecular weight of 288.42 g/mol, XLogP of 2.29, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;triethoxy(3-isocyanatopropyl)silane is sourced from PubChem (CID 158725312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).