About 3-chloropropyl(triethoxy)silane;isocyanatosilane
3-chloropropyl(triethoxy)silane;isocyanatosilane (PubChem CID 175325315) has the molecular formula C10H24ClNO4Si2
and a molecular weight of 313.93 g/mol. Its IUPAC name is 3-chloropropyl(triethoxy)silane;isocyanatosilane.
Molecular Properties
| Compound Name | 3-chloropropyl(triethoxy)silane;isocyanatosilane |
| PubChem CID | 175325315 |
| Molecular Formula | C10H24ClNO4Si2 |
| Molecular Weight | 313.93 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-chloropropyl(triethoxy)silane;isocyanatosilane |
| SMILES | CCO[Si](CCCCl)(OCC)OCC.O=C=N[SiH3] |
| InChI | InChI=1S/C9H21ClO3Si.CH3NOSi/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;3-1-2-4/h4-9H2,1-3H3;4H3 |
| InChIKey | GKCSLWPWUODYSA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.93 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-chloropropyl(triethoxy)silane;isocyanatosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloropropyl(triethoxy)silane;isocyanatosilane?
The IUPAC name of 3-chloropropyl(triethoxy)silane;isocyanatosilane (CID 175325315) is 3-chloropropyl(triethoxy)silane;isocyanatosilane.
What is the SMILES notation for 3-chloropropyl(triethoxy)silane;isocyanatosilane?
The canonical SMILES for 3-chloropropyl(triethoxy)silane;isocyanatosilane is CCO[Si](CCCCl)(OCC)OCC.O=C=N[SiH3].
What is the InChIKey of 3-chloropropyl(triethoxy)silane;isocyanatosilane?
The InChIKey is GKCSLWPWUODYSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21ClO3Si.CH3NOSi/c1-4-11-14(12-5-2,13-6-3)9-7-8-10;3-1-2-4/h4-9H2,1-3H3;4H3.
What are the key properties of 3-chloropropyl(triethoxy)silane;isocyanatosilane?
3-chloropropyl(triethoxy)silane;isocyanatosilane has a molecular weight of 313.93 g/mol, XLogP of 1.27, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloropropyl(triethoxy)silane;isocyanatosilane is sourced from PubChem (CID 175325315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).