About nitrosomethanediol
nitrosomethanediol (PubChem CID 142787686) has the molecular formula CH3NO3
and a molecular weight of 77.04 g/mol. Its IUPAC name is nitrosomethanediol.
Molecular Properties
| Compound Name | nitrosomethanediol |
| PubChem CID | 142787686 |
| Molecular Formula | CH3NO3 |
| Molecular Weight | 77.04 g/mol |
| Exact Mass | 77.01 |
| IUPAC Name | nitrosomethanediol |
| SMILES | O=NC(O)O |
| InChI | InChI=1S/CH3NO3/c3-1(4)2-5/h1,3-4H |
| InChIKey | SKAXMOPDNYWHFC-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 77.04 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze nitrosomethanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrosomethanediol?
The IUPAC name of nitrosomethanediol (CID 142787686) is nitrosomethanediol.
What is the SMILES notation for nitrosomethanediol?
The canonical SMILES for nitrosomethanediol is O=NC(O)O.
What is the InChIKey of nitrosomethanediol?
The InChIKey is SKAXMOPDNYWHFC-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3NO3/c3-1(4)2-5/h1,3-4H.
What are the key properties of nitrosomethanediol?
nitrosomethanediol has a molecular weight of 77.04 g/mol, XLogP of -0.98, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitrosomethanediol is sourced from PubChem (CID 142787686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).