C4H6NNaO4 — CID 141437494
sodium (2S,3R)-3-hydroxy-2-nitrosobutanoate (PubChem CID 141437494) has the molecular formula C4H6NNaO4 and a molecular weight of 155.08 g/mol. Its IUPAC name is sodium (2S,3R)-3-hydroxy-2-nitrosobutanoate.
| Compound Name | sodium (2S,3R)-3-hydroxy-2-nitrosobutanoate |
|---|---|
| PubChem CID | 141437494 |
| Molecular Formula | C4H6NNaO4 |
| Molecular Weight | 155.08 g/mol |
| Exact Mass | 155.02 |
| IUPAC Name | sodium (2S,3R)-3-hydroxy-2-nitrosobutanoate |
| SMILES | C[C@@H](O)[C@H](N=O)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H7NO4.Na/c1-2(6)3(5-9)4(7)8;/h2-3,6H,1H3,(H,7,8);/q;+1/p-1/t2-,3+;/m1./s1 |
| InChIKey | CKHRXBZLCHVXNL-MUWMCQJSSA-M |
| XLogP | -4.74 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.08 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |