C6H14N2O9 — CID 175089243
nitric acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 175089243) has the molecular formula C6H14N2O9 and a molecular weight of 258.18 g/mol. Its IUPAC name is nitric acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | nitric acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 175089243 |
| Molecular Formula | C6H14N2O9 |
| Molecular Weight | 258.18 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | nitric acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | NC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=[N+]([O-])O |
| InChI | InChI=1S/C6H13NO6.HNO3/c7-6(13)5(12)4(11)3(10)2(9)1-8;2-1(3)4/h2-5,8-12H,1H2,(H2,7,13);(H,2,3,4)/t2-,3-,4+,5-;/m1./s1 |
| InChIKey | SZTQGNWRFPHMGA-JJKGCWMISA-N |
| XLogP | -4.44 |
| TPSA | 207.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.18 |
| LogP ≤ 5 | -4.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|