C11H27N3O6 — CID 87948999
2-methylbutane-2,3-diamine;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 87948999) has the molecular formula C11H27N3O6 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-methylbutane-2,3-diamine;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | 2-methylbutane-2,3-diamine;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 87948999 |
| Molecular Formula | C11H27N3O6 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 2-methylbutane-2,3-diamine;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | CC(N)C(C)(C)N.NC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H13NO6.C5H14N2/c7-6(13)5(12)4(11)3(10)2(9)1-8;1-4(6)5(2,3)7/h2-5,8-12H,1H2,(H2,7,13);4H,6-7H2,1-3H3/t2-,3-,4+,5-;/m1./s1 |
| InChIKey | TVTBRGZHPCSBRX-JJKGCWMISA-N |
| XLogP | -4.02 |
| TPSA | 196.28 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | -4.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |