C6H13NO6 — CID 141062864
(2S,3S,4R,5R)-N-deuterio-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 141062864) has the molecular formula C6H13NO6 and a molecular weight of 196.18 g/mol. Its IUPAC name is (2S,3S,4R,5R)-N-deuterio-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (2S,3S,4R,5R)-N-deuterio-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 141062864 |
| Molecular Formula | C6H13NO6 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (2S,3S,4R,5R)-N-deuterio-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | [2H]NC(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H13NO6/c7-6(13)5(12)4(11)3(10)2(9)1-8/h2-5,8-12H,1H2,(H2,7,13)/t2-,3-,4+,5+/m1/s1/i/hD |
| InChIKey | JCZPMGDSEAFWDY-PHWYCRCFSA-N |
| XLogP | -4.09 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |