C4H11NO6 — CID 159478101
methanol;1-nitropropane-1,2,3-triol (PubChem CID 159478101) has the molecular formula C4H11NO6 and a molecular weight of 169.13 g/mol. Its IUPAC name is methanol;1-nitropropane-1,2,3-triol.
| Compound Name | methanol;1-nitropropane-1,2,3-triol |
|---|---|
| PubChem CID | 159478101 |
| Molecular Formula | C4H11NO6 |
| Molecular Weight | 169.13 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | methanol;1-nitropropane-1,2,3-triol |
| SMILES | CO.O=[N+]([O-])C(O)C(O)CO |
| InChI | InChI=1S/C3H7NO5.CH4O/c5-1-2(6)3(7)4(8)9;1-2/h2-3,5-7H,1H2;2H,1H3 |
| InChIKey | LWQKOZIFTBCAAC-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 124.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.13 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|