C10H15NO5 — CID 158460335
1-nitropropane-1,2,3-triol;toluene (PubChem CID 158460335) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is 1-nitropropane-1,2,3-triol;toluene.
| Compound Name | 1-nitropropane-1,2,3-triol;toluene |
|---|---|
| PubChem CID | 158460335 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 1-nitropropane-1,2,3-triol;toluene |
| SMILES | Cc1ccccc1.O=[N+]([O-])C(O)C(O)CO |
| InChI | InChI=1S/C7H8.C3H7NO5/c1-7-5-3-2-4-6-7;5-1-2(6)3(7)4(8)9/h2-6H,1H3;2-3,5-7H,1H2 |
| InChIKey | HFBZVVSIPPGBNN-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|