C4H8N2O4S2 — CID 100919953
(2R,3R)-1,4-bis(nitrososulfanyl)butane-2,3-diol (PubChem CID 100919953) has the molecular formula C4H8N2O4S2 and a molecular weight of 212.25 g/mol. Its IUPAC name is (2R,3R)-1,4-bis(nitrososulfanyl)butane-2,3-diol.
| Compound Name | (2R,3R)-1,4-bis(nitrososulfanyl)butane-2,3-diol |
|---|---|
| PubChem CID | 100919953 |
| Molecular Formula | C4H8N2O4S2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | (2R,3R)-1,4-bis(nitrososulfanyl)butane-2,3-diol |
| SMILES | O=NSC[C@H](O)[C@@H](O)CSN=O |
| InChI | InChI=1S/C4H8N2O4S2/c7-3(1-11-5-9)4(8)2-12-6-10/h3-4,7-8H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | VEGVZEGLLVWGAN-IMJSIDKUSA-N |
| XLogP | 0.54 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|