C7H13N3O3 — CID 10375192
(2S,3S)-2-azido-4-prop-2-enoxybutane-1,3-diol (PubChem CID 10375192) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is (2S,3S)-2-azido-4-prop-2-enoxybutane-1,3-diol.
| Compound Name | (2S,3S)-2-azido-4-prop-2-enoxybutane-1,3-diol |
|---|---|
| PubChem CID | 10375192 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | (2S,3S)-2-azido-4-prop-2-enoxybutane-1,3-diol |
| SMILES | C=CCOC[C@@H](O)[C@H](CO)N=[N+]=[N-] |
| InChI | InChI=1S/C7H13N3O3/c1-2-3-13-5-7(12)6(4-11)9-10-8/h2,6-7,11-12H,1,3-5H2/t6-,7+/m0/s1 |
| InChIKey | OTIUFVNVVOIYRV-NKWVEPMBSA-N |
| XLogP | 0.22 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|