C7H18N2O4 — CID 46884294
(2S,3S,5S,6S)-2,6-diaminoheptane-1,3,5,7-tetrol (PubChem CID 46884294) has the molecular formula C7H18N2O4 and a molecular weight of 194.23 g/mol. Its IUPAC name is (2S,3S,5S,6S)-2,6-diaminoheptane-1,3,5,7-tetrol.
| Compound Name | (2S,3S,5S,6S)-2,6-diaminoheptane-1,3,5,7-tetrol |
|---|---|
| PubChem CID | 46884294 |
| Molecular Formula | C7H18N2O4 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (2S,3S,5S,6S)-2,6-diaminoheptane-1,3,5,7-tetrol |
| SMILES | N[C@@H](CO)[C@@H](O)C[C@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C7H18N2O4/c8-4(2-10)6(12)1-7(13)5(9)3-11/h4-7,10-13H,1-3,8-9H2/t4-,5-,6-,7-/m0/s1 |
| InChIKey | CVXNAVDRMVPUOS-AXMZGBSTSA-N |
| XLogP | -3.26 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |