C12H26O4 — CID 173122486
(4S,6S,7R)-3-ethyl-4-(2-hydroxyethyl)octane-1,6,7-triol (PubChem CID 173122486) has the molecular formula C12H26O4 and a molecular weight of 234.34 g/mol. Its IUPAC name is (4S,6S,7R)-3-ethyl-4-(2-hydroxyethyl)octane-1,6,7-triol.
| Compound Name | (4S,6S,7R)-3-ethyl-4-(2-hydroxyethyl)octane-1,6,7-triol |
|---|---|
| PubChem CID | 173122486 |
| Molecular Formula | C12H26O4 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | (4S,6S,7R)-3-ethyl-4-(2-hydroxyethyl)octane-1,6,7-triol |
| SMILES | CCC(CCO)C(CCO)C[C@H](O)[C@@H](C)O |
| InChI | InChI=1S/C12H26O4/c1-3-10(4-6-13)11(5-7-14)8-12(16)9(2)15/h9-16H,3-8H2,1-2H3/t9-,10?,11?,12+/m1/s1 |
| InChIKey | RHLIGWPOBWZOOD-YYJSSNLHSA-N |
| XLogP | 0.53 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |