C3H10N2O3 — CID 123718232
1-amino-2-(hydroxymethylamino)ethane-1,2-diol (PubChem CID 123718232) has the molecular formula C3H10N2O3 and a molecular weight of 122.12 g/mol. Its IUPAC name is 1-amino-2-(hydroxymethylamino)ethane-1,2-diol.
| Compound Name | 1-amino-2-(hydroxymethylamino)ethane-1,2-diol |
|---|---|
| PubChem CID | 123718232 |
| Molecular Formula | C3H10N2O3 |
| Molecular Weight | 122.12 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | 1-amino-2-(hydroxymethylamino)ethane-1,2-diol |
| SMILES | NC(O)C(O)NCO |
| InChI | InChI=1S/C3H10N2O3/c4-2(7)3(8)5-1-6/h2-3,5-8H,1,4H2 |
| InChIKey | QQEZZXSHKBKWGH-UHFFFAOYSA-N |
| XLogP | -2.88 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.12 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|