C5H12F2N2O — CID 134269576
2-amino-1-(2,2-difluoroethylamino)propan-1-ol (PubChem CID 134269576) has the molecular formula C5H12F2N2O and a molecular weight of 154.16 g/mol. Its IUPAC name is 2-amino-1-(2,2-difluoroethylamino)propan-1-ol.
| Compound Name | 2-amino-1-(2,2-difluoroethylamino)propan-1-ol |
|---|---|
| PubChem CID | 134269576 |
| Molecular Formula | C5H12F2N2O |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 2-amino-1-(2,2-difluoroethylamino)propan-1-ol |
| SMILES | CC(N)C(O)NCC(F)F |
| InChI | InChI=1S/C5H12F2N2O/c1-3(8)5(10)9-2-4(6)7/h3-5,9-10H,2,8H2,1H3 |
| InChIKey | GDHVIRVIPIEZHF-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|