C6H18N4O2 — CID 88578743
(3R)-3-amino-2-(hydroxymethylamino)-1,3-bis(methylamino)propan-1-ol (PubChem CID 88578743) has the molecular formula C6H18N4O2 and a molecular weight of 178.24 g/mol. Its IUPAC name is (3R)-3-amino-2-(hydroxymethylamino)-1,3-bis(methylamino)propan-1-ol.
| Compound Name | (3R)-3-amino-2-(hydroxymethylamino)-1,3-bis(methylamino)propan-1-ol |
|---|---|
| PubChem CID | 88578743 |
| Molecular Formula | C6H18N4O2 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (3R)-3-amino-2-(hydroxymethylamino)-1,3-bis(methylamino)propan-1-ol |
| SMILES | CNC(O)C(NCO)[C@H](N)NC |
| InChI | InChI=1S/C6H18N4O2/c1-8-5(7)4(10-3-11)6(12)9-2/h4-6,8-12H,3,7H2,1-2H3/t4?,5-,6?/m1/s1 |
| InChIKey | JNSQNMTVTGXPMX-INWUZDNDSA-N |
| XLogP | -3.06 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|