C8H18N2O2 — CID 159639696
4-amino-4-cyclopropyl-1-(methylamino)butane-1,2-diol (PubChem CID 159639696) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is 4-amino-4-cyclopropyl-1-(methylamino)butane-1,2-diol.
| Compound Name | 4-amino-4-cyclopropyl-1-(methylamino)butane-1,2-diol |
|---|---|
| PubChem CID | 159639696 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 4-amino-4-cyclopropyl-1-(methylamino)butane-1,2-diol |
| SMILES | CNC(O)C(O)CC(N)C1CC1 |
| InChI | InChI=1S/C8H18N2O2/c1-10-8(12)7(11)4-6(9)5-2-3-5/h5-8,10-12H,2-4,9H2,1H3 |
| InChIKey | MQERHGJQVQOHJU-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|