C6H13NO2 — CID 174886363
1-amino-3-cyclopropylpropane-1,3-diol (PubChem CID 174886363) has the molecular formula C6H13NO2 and a molecular weight of 131.18 g/mol. Its IUPAC name is 1-amino-3-cyclopropylpropane-1,3-diol.
| Compound Name | 1-amino-3-cyclopropylpropane-1,3-diol |
|---|---|
| PubChem CID | 174886363 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 1-amino-3-cyclopropylpropane-1,3-diol |
| SMILES | NC(O)CC(O)C1CC1 |
| InChI | InChI=1S/C6H13NO2/c7-6(9)3-5(8)4-1-2-4/h4-6,8-9H,1-3,7H2 |
| InChIKey | SLJYXZMFAWNULI-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|