C5H11NO2 — CID 130242537
(2R)-2-amino-2-cyclopropylethane-1,1-diol (PubChem CID 130242537) has the molecular formula C5H11NO2 and a molecular weight of 117.15 g/mol. Its IUPAC name is (2R)-2-amino-2-cyclopropylethane-1,1-diol.
| Compound Name | (2R)-2-amino-2-cyclopropylethane-1,1-diol |
|---|---|
| PubChem CID | 130242537 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | (2R)-2-amino-2-cyclopropylethane-1,1-diol |
| SMILES | N[C@@H](C(O)O)C1CC1 |
| InChI | InChI=1S/C5H11NO2/c6-4(5(7)8)3-1-2-3/h3-5,7-8H,1-2,6H2/t4-/m1/s1 |
| InChIKey | DDPDYSAIIJPANJ-SCSAIBSYSA-N |
| XLogP | -0.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|