C15H30N2O — CID 140971393
1,3-diamino-1,3-dicyclohexylpropan-2-ol (PubChem CID 140971393) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 1,3-diamino-1,3-dicyclohexylpropan-2-ol.
| Compound Name | 1,3-diamino-1,3-dicyclohexylpropan-2-ol |
|---|---|
| PubChem CID | 140971393 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 1,3-diamino-1,3-dicyclohexylpropan-2-ol |
| SMILES | NC(C1CCCCC1)C(O)C(N)C1CCCCC1 |
| InChI | InChI=1S/C15H30N2O/c16-13(11-7-3-1-4-8-11)15(18)14(17)12-9-5-2-6-10-12/h11-15,18H,1-10,16-17H2 |
| InChIKey | AOPKKVGHVDDJBO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |