C8H17NO3 — CID 90745280
2-amino-2-(2-hydroxycyclohexyl)ethane-1,1-diol (PubChem CID 90745280) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-amino-2-(2-hydroxycyclohexyl)ethane-1,1-diol.
| Compound Name | 2-amino-2-(2-hydroxycyclohexyl)ethane-1,1-diol |
|---|---|
| PubChem CID | 90745280 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 2-amino-2-(2-hydroxycyclohexyl)ethane-1,1-diol |
| SMILES | NC(C(O)O)C1CCCCC1O |
| InChI | InChI=1S/C8H17NO3/c9-7(8(11)12)5-3-1-2-4-6(5)10/h5-8,10-12H,1-4,9H2 |
| InChIKey | ABGQVOXXTXYXHB-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|