About 1-cyclopropylheptane-1,3-diol
1-cyclopropylheptane-1,3-diol (PubChem CID 174466446) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is 1-cyclopropylheptane-1,3-diol.
Molecular Properties
| Compound Name | 1-cyclopropylheptane-1,3-diol |
| PubChem CID | 174466446 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | 1-cyclopropylheptane-1,3-diol |
| SMILES | CCCCC(O)CC(O)C1CC1 |
| InChI | InChI=1S/C10H20O2/c1-2-3-4-9(11)7-10(12)8-5-6-8/h8-12H,2-7H2,1H3 |
| InChIKey | WPIFPTFJUCVZLH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropylheptane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylheptane-1,3-diol?
The IUPAC name of 1-cyclopropylheptane-1,3-diol (CID 174466446) is 1-cyclopropylheptane-1,3-diol.
What is the SMILES notation for 1-cyclopropylheptane-1,3-diol?
The canonical SMILES for 1-cyclopropylheptane-1,3-diol is CCCCC(O)CC(O)C1CC1.
What is the InChIKey of 1-cyclopropylheptane-1,3-diol?
The InChIKey is WPIFPTFJUCVZLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2/c1-2-3-4-9(11)7-10(12)8-5-6-8/h8-12H,2-7H2,1H3.
What are the key properties of 1-cyclopropylheptane-1,3-diol?
1-cyclopropylheptane-1,3-diol has a molecular weight of 172.27 g/mol, XLogP of 1.70, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylheptane-1,3-diol is sourced from PubChem (CID 174466446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).