C6H16N2O4 — CID 59800336
1,2-bis(2-hydroxyethylamino)ethane-1,2-diol (PubChem CID 59800336) has the molecular formula C6H16N2O4 and a molecular weight of 180.20 g/mol. Its IUPAC name is 1,2-bis(2-hydroxyethylamino)ethane-1,2-diol.
| Compound Name | 1,2-bis(2-hydroxyethylamino)ethane-1,2-diol |
|---|---|
| PubChem CID | 59800336 |
| Molecular Formula | C6H16N2O4 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.11 |
| IUPAC Name | 1,2-bis(2-hydroxyethylamino)ethane-1,2-diol |
| SMILES | OCCNC(O)C(O)NCCO |
| InChI | InChI=1S/C6H16N2O4/c9-3-1-7-5(11)6(12)8-2-4-10/h5-12H,1-4H2 |
| InChIKey | ZPBLYJVOJPOXME-UHFFFAOYSA-N |
| XLogP | -3.21 |
| TPSA | 104.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|