C11H28N4O5 — CID 90097181
1,1,3,3-tetrakis(2-hydroxyethylamino)propan-2-ol (PubChem CID 90097181) has the molecular formula C11H28N4O5 and a molecular weight of 296.37 g/mol. Its IUPAC name is 1,1,3,3-tetrakis(2-hydroxyethylamino)propan-2-ol.
| Compound Name | 1,1,3,3-tetrakis(2-hydroxyethylamino)propan-2-ol |
|---|---|
| PubChem CID | 90097181 |
| Molecular Formula | C11H28N4O5 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 1,1,3,3-tetrakis(2-hydroxyethylamino)propan-2-ol |
| SMILES | OCCNC(NCCO)C(O)C(NCCO)NCCO |
| InChI | InChI=1S/C11H28N4O5/c16-5-1-12-10(13-2-6-17)9(20)11(14-3-7-18)15-4-8-19/h9-20H,1-8H2 |
| InChIKey | CZTUGOJXUWKZLP-UHFFFAOYSA-N |
| XLogP | -4.67 |
| TPSA | 149.27 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | -4.67 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|