C5H13NO4 — CID 156780277
1-(2-hydroxyethylamino)propane-1,2,3-triol (PubChem CID 156780277) has the molecular formula C5H13NO4 and a molecular weight of 151.16 g/mol. Its IUPAC name is 1-(2-hydroxyethylamino)propane-1,2,3-triol.
| Compound Name | 1-(2-hydroxyethylamino)propane-1,2,3-triol |
|---|---|
| PubChem CID | 156780277 |
| Molecular Formula | C5H13NO4 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 1-(2-hydroxyethylamino)propane-1,2,3-triol |
| SMILES | OCCNC(O)C(O)CO |
| InChI | InChI=1S/C5H13NO4/c7-2-1-6-5(10)4(9)3-8/h4-10H,1-3H2 |
| InChIKey | BTMHPJULXOBMEA-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|