C10H24N2O6 — CID 102066006
(2R,3S)-3-[2-[[(2S,3R)-1,3,4-trihydroxybutan-2-yl]amino]ethylamino]butane-1,2,4-triol (PubChem CID 102066006) has the molecular formula C10H24N2O6 and a molecular weight of 268.31 g/mol. Its IUPAC name is (2R,3S)-3-[2-[[(2S,3R)-1,3,4-trihydroxybutan-2-yl]amino]ethylamino]butane-1,2,4-triol.
| Compound Name | (2R,3S)-3-[2-[[(2S,3R)-1,3,4-trihydroxybutan-2-yl]amino]ethylamino]butane-1,2,4-triol |
|---|---|
| PubChem CID | 102066006 |
| Molecular Formula | C10H24N2O6 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (2R,3S)-3-[2-[[(2S,3R)-1,3,4-trihydroxybutan-2-yl]amino]ethylamino]butane-1,2,4-triol |
| SMILES | OC[C@H](NCCN[C@@H](CO)[C@@H](O)CO)[C@@H](O)CO |
| InChI | InChI=1S/C10H24N2O6/c13-3-7(9(17)5-15)11-1-2-12-8(4-14)10(18)6-16/h7-18H,1-6H2/t7-,8-,9-,10-/m0/s1 |
| InChIKey | TUWZKIHDKNBGSR-XKNYDFJKSA-N |
| XLogP | -4.41 |
| TPSA | 145.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | -4.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|