C6H16N2O5 — CID 54442967
(2R,3R,4R,5S)-5-hydrazinylhexane-1,2,3,4,6-pentol (PubChem CID 54442967) has the molecular formula C6H16N2O5 and a molecular weight of 196.20 g/mol. Its IUPAC name is (2R,3R,4R,5S)-5-hydrazinylhexane-1,2,3,4,6-pentol.
| Compound Name | (2R,3R,4R,5S)-5-hydrazinylhexane-1,2,3,4,6-pentol |
|---|---|
| PubChem CID | 54442967 |
| Molecular Formula | C6H16N2O5 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (2R,3R,4R,5S)-5-hydrazinylhexane-1,2,3,4,6-pentol |
| SMILES | NN[C@@H](CO)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H16N2O5/c7-8-3(1-9)5(12)6(13)4(11)2-10/h3-6,8-13H,1-2,7H2/t3-,4+,5+,6-/m0/s1 |
| InChIKey | WPLKINDJYZFEPG-KCDKBNATSA-N |
| XLogP | -4.11 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|