C6H16N2O6 — CID 54413278
(2S,3S,4R,5R)-1-hydrazinylhexane-1,2,3,4,5,6-hexol (PubChem CID 54413278) has the molecular formula C6H16N2O6 and a molecular weight of 212.20 g/mol. Its IUPAC name is (2S,3S,4R,5R)-1-hydrazinylhexane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3S,4R,5R)-1-hydrazinylhexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 54413278 |
| Molecular Formula | C6H16N2O6 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (2S,3S,4R,5R)-1-hydrazinylhexane-1,2,3,4,5,6-hexol |
| SMILES | NNC(O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H16N2O6/c7-8-6(14)5(13)4(12)3(11)2(10)1-9/h2-6,8-14H,1,7H2/t2-,3-,4+,5+,6?/m1/s1 |
| InChIKey | VVQFBXGCNFTORR-QTVWNMPRSA-N |
| XLogP | -4.80 |
| TPSA | 159.43 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -4.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|