C11H28O11 — CID 161114526
ethane-1,2-diol;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;propane-1,2,3-triol (PubChem CID 161114526) has the molecular formula C11H28O11 and a molecular weight of 336.33 g/mol. Its IUPAC name is ethane-1,2-diol;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;propane-1,2,3-triol.
| Compound Name | ethane-1,2-diol;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;propane-1,2,3-triol |
|---|---|
| PubChem CID | 161114526 |
| Molecular Formula | C11H28O11 |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | ethane-1,2-diol;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol;propane-1,2,3-triol |
| SMILES | OCC(O)CO.OCCO.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H14O6.C3H8O3.C2H6O2/c7-1-3(9)5(11)6(12)4(10)2-8;4-1-3(6)2-5;3-1-2-4/h3-12H,1-2H2;3-6H,1-2H2;3-4H,1-2H2/t3-,4+,5-,6-;;/m1../s1 |
| InChIKey | UKDDPPYSZSLAJG-MGXNYLRYSA-N |
| XLogP | -6.28 |
| TPSA | 222.53 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | -6.28 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 11 |