C10H22N4O2 — CID 21019160
3,4-bis(2-aminoethylamino)hexanedial (PubChem CID 21019160) has the molecular formula C10H22N4O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3,4-bis(2-aminoethylamino)hexanedial.
| Compound Name | 3,4-bis(2-aminoethylamino)hexanedial |
|---|---|
| PubChem CID | 21019160 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 3,4-bis(2-aminoethylamino)hexanedial |
| SMILES | NCCNC(CC=O)C(CC=O)NCCN |
| InChI | InChI=1S/C10H22N4O2/c11-3-5-13-9(1-7-15)10(2-8-16)14-6-4-12/h7-10,13-14H,1-6,11-12H2 |
| InChIKey | UHYUJWFDAXRZJP-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|