C10H30O10Si5 — CID 155649673
[4-(hydroxymethyl)-6,8,10-trimethoxy-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]methanol (PubChem CID 155649673) has the molecular formula C10H30O10Si5 and a molecular weight of 450.77 g/mol. Its IUPAC name is [4-(hydroxymethyl)-6,8,10-trimethoxy-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]methanol.
| Compound Name | [4-(hydroxymethyl)-6,8,10-trimethoxy-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]methanol |
|---|---|
| PubChem CID | 155649673 |
| Molecular Formula | C10H30O10Si5 |
| Molecular Weight | 450.77 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | [4-(hydroxymethyl)-6,8,10-trimethoxy-2,4,6,8,10-pentamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecan-2-yl]methanol |
| SMILES | CO[Si]1(C)O[Si](C)(CO)O[Si](C)(CO)O[Si](C)(OC)O[Si](C)(OC)O1 |
| InChI | InChI=1S/C10H30O10Si5/c1-13-23(6)17-21(4,9-11)16-22(5,10-12)18-24(7,14-2)20-25(8,15-3)19-23/h11-12H,9-10H2,1-8H3 |
| InChIKey | XCTOCRKMKBFQPV-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.77 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|