C17H52O18Si9 — CID 140741024
bis[[dimethoxy(methyl)silyl]oxy]-[(8-hydroxy-4,6,10,12-tetramethoxy-2,4,6,8,10,12-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododec-2-yl)oxy]-methylsilane (PubChem CID 140741024) has the molecular formula C17H52O18Si9 and a molecular weight of 797.36 g/mol. Its IUPAC name is bis[[dimethoxy(methyl)silyl]oxy]-[(8-hydroxy-4,6,10,12-tetramethoxy-2,4,6,8,10,12-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododec-2-yl)oxy]-methylsilane.
| Compound Name | bis[[dimethoxy(methyl)silyl]oxy]-[(8-hydroxy-4,6,10,12-tetramethoxy-2,4,6,8,10,12-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododec-2-yl)oxy]-methylsilane |
|---|---|
| PubChem CID | 140741024 |
| Molecular Formula | C17H52O18Si9 |
| Molecular Weight | 797.36 g/mol |
| Exact Mass | 796.11 |
| IUPAC Name | bis[[dimethoxy(methyl)silyl]oxy]-[(8-hydroxy-4,6,10,12-tetramethoxy-2,4,6,8,10,12-hexamethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododec-2-yl)oxy]-methylsilane |
| SMILES | CO[Si](C)(OC)O[Si](C)(O[Si](C)(OC)OC)O[Si]1(C)O[Si](C)(OC)O[Si](C)(OC)O[Si](C)(O)O[Si](C)(OC)O[Si](C)(OC)O1 |
| InChI | InChI=1S/C17H52O18Si9/c1-19-37(10,20-2)29-43(16,30-38(11,21-3)22-4)35-44(17)33-41(14,25-7)31-39(12,23-5)27-36(9,18)28-40(13,24-6)32-42(15,26-8)34-44/h18H,1-17H3 |
| InChIKey | JNNLDKKJNGAJDH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 177.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|