C7H26O11Si5 — CID 161330417
2,4-dihydroxy-6,8-dimethoxy-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;trihydroxy(methyl)silane (PubChem CID 161330417) has the molecular formula C7H26O11Si5 and a molecular weight of 426.70 g/mol. Its IUPAC name is 2,4-dihydroxy-6,8-dimethoxy-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;trihydroxy(methyl)silane.
| Compound Name | 2,4-dihydroxy-6,8-dimethoxy-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;trihydroxy(methyl)silane |
|---|---|
| PubChem CID | 161330417 |
| Molecular Formula | C7H26O11Si5 |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 2,4-dihydroxy-6,8-dimethoxy-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;trihydroxy(methyl)silane |
| SMILES | CO[Si]1(C)O[Si](C)(O)O[Si](C)(O)O[Si](C)(OC)O1.C[Si](O)(O)O |
| InChI | InChI=1S/C6H20O8Si4.CH6O3Si/c1-9-17(5)12-15(3,7)11-16(4,8)13-18(6,10-2)14-17;1-5(2,3)4/h7-8H,1-6H3;2-4H,1H3 |
| InChIKey | VLINNMLRJQALDJ-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 156.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|