About CID 58121278
CID 58121278 (PubChem CID 58121278) has the molecular formula C10H30O12Si8
and a molecular weight of 567.03 g/mol.
Molecular Properties
| Compound Name | CID 58121278 |
| PubChem CID | 58121278 |
| Molecular Formula | C10H30O12Si8 |
| Molecular Weight | 567.03 g/mol |
| Exact Mass | 565.99 |
| IUPAC Name | — |
| SMILES | CO[Si]1(C)O[Si](C)O[Si]2(C)O[Si](C)O[Si]3(C)O[Si](C)(O1)O[Si](C)(OC)O[Si@@](C)(O2)O3 |
| InChI | InChI=1S/C10H30O12Si8/c1-11-25(5)13-23(3)14-27(7)15-24(4)16-28(8)21-29(9,17-25)18-26(6,12-2)19-30(10,20-27)22-28/h1-10H3/t25?,26?,27?,28?,29?,30-/m0/s1 |
| InChIKey | XLDPRCUPNYEMLX-PFKQAVRKSA-N |
| XLogP | 1.13 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.03 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58121278 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58121278?
The IUPAC name of CID 58121278 (CID 58121278) is not available.
What is the SMILES notation for CID 58121278?
The canonical SMILES for CID 58121278 is CO[Si]1(C)O[Si](C)O[Si]2(C)O[Si](C)O[Si]3(C)O[Si](C)(O1)O[Si](C)(OC)O[Si@@](C)(O2)O3.
What is the InChIKey of CID 58121278?
The InChIKey is XLDPRCUPNYEMLX-PFKQAVRKSA-N. The full InChI is InChI=1S/C10H30O12Si8/c1-11-25(5)13-23(3)14-27(7)15-24(4)16-28(8)21-29(9,17-25)18-26(6,12-2)19-30(10,20-27)22-28/h1-10H3/t25?,26?,27?,28?,29?,30-/m0/s1.
What are the key properties of CID 58121278?
CID 58121278 has a molecular weight of 567.03 g/mol, XLogP of 1.13, 2 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58121278 is sourced from PubChem (CID 58121278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).