C10H30O12Si8 — CID 58121278
CID 58121278 (PubChem CID 58121278) has the molecular formula C10H30O12Si8 and a molecular weight of 567.03 g/mol.
| Compound Name | CID 58121278 |
|---|---|
| PubChem CID | 58121278 |
| Molecular Formula | C10H30O12Si8 |
| Molecular Weight | 567.03 g/mol |
| Exact Mass | 565.99 |
| IUPAC Name | — |
| SMILES | CO[Si]1(C)O[Si](C)O[Si]2(C)O[Si](C)O[Si]3(C)O[Si](C)(O1)O[Si](C)(OC)O[Si@@](C)(O2)O3 |
| InChI | InChI=1S/C10H30O12Si8/c1-11-25(5)13-23(3)14-27(7)15-24(4)16-28(8)21-29(9,17-25)18-26(6,12-2)19-30(10,20-27)22-28/h1-10H3/t25?,26?,27?,28?,29?,30-/m0/s1 |
| InChIKey | XLDPRCUPNYEMLX-PFKQAVRKSA-N |
| XLogP | 1.13 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.03 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|