C36H108O24Si24 — CID 177454225
CID 177454225 (PubChem CID 177454225) has the molecular formula C36H108O24Si24 and a molecular weight of 1599.30 g/mol.
| Compound Name | CID 177454225 |
|---|---|
| PubChem CID | 177454225 |
| Molecular Formula | C36H108O24Si24 |
| Molecular Weight | 1599.30 g/mol |
| Exact Mass | 1596.17 |
| IUPAC Name | — |
| SMILES | C[Si](C)O[Si]1(C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O1 |
| InChI | InChI=1S/C36H108O24Si24/c1-61(2)37-73(25)49-74(26,38-62(3)4)51-76(28,40-64(7)8)53-78(30,42-66(11)12)55-80(32,44-68(15)16)57-82(34,46-70(19)20)59-84(36,48-72(23)24)60-83(35,47-71(21)22)58-81(33,45-69(17)18)56-79(31,43-67(13)14)54-77(29,41-65(9)10)52-75(27,50-73)39-63(5)6/h1-36H3 |
| InChIKey | HONKJIQTMRKRDF-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 221.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1599.30 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|