About CID 177454225
CID 177454225 (PubChem CID 177454225) has the molecular formula C36H108O24Si24
and a molecular weight of 1599.30 g/mol.
Molecular Properties
| Compound Name | CID 177454225 |
| PubChem CID | 177454225 |
| Molecular Formula | C36H108O24Si24 |
| Molecular Weight | 1599.30 g/mol |
| Exact Mass | 1596.17 |
| IUPAC Name | — |
| SMILES | C[Si](C)O[Si]1(C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O1 |
| InChI | InChI=1S/C36H108O24Si24/c1-61(2)37-73(25)49-74(26,38-62(3)4)51-76(28,40-64(7)8)53-78(30,42-66(11)12)55-80(32,44-68(15)16)57-82(34,46-70(19)20)59-84(36,48-72(23)24)60-83(35,47-71(21)22)58-81(33,45-69(17)18)56-79(31,43-67(13)14)54-77(29,41-65(9)10)52-75(27,50-73)39-63(5)6/h1-36H3 |
| InChIKey | HONKJIQTMRKRDF-UHFFFAOYSA-N |
| XLogP | 10.24 |
| TPSA | 221.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 84 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1599.30 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177454225 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177454225?
The IUPAC name of CID 177454225 (CID 177454225) is not available.
What is the SMILES notation for CID 177454225?
The canonical SMILES for CID 177454225 is C[Si](C)O[Si]1(C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O[Si](C)(O[Si](C)C)O1.
What is the InChIKey of CID 177454225?
The InChIKey is HONKJIQTMRKRDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H108O24Si24/c1-61(2)37-73(25)49-74(26,38-62(3)4)51-76(28,40-64(7)8)53-78(30,42-66(11)12)55-80(32,44-68(15)16)57-82(34,46-70(19)20)59-84(36,48-72(23)24)60-83(35,47-71(21)22)58-81(33,45-69(17)18)56-79(31,43-67(13)14)54-77(29,41-65(9)10)52-75(27,50-73)39-63(5)6/h1-36H3.
What are the key properties of CID 177454225?
CID 177454225 has a molecular weight of 1599.30 g/mol, XLogP of 10.24, 24 rotatable bonds, 0 hydrogen bond donors, and 24 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177454225 is sourced from PubChem (CID 177454225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).