C14H42O6Si7 — CID 6329088
1,1,3,3,5,5,7,7,9,9,11,11,13,13-Tetradecamethylheptasiloxane (PubChem CID 6329088) has the molecular formula C14H42O6Si7 and a molecular weight of 503.09 g/mol.
| Compound Name | 1,1,3,3,5,5,7,7,9,9,11,11,13,13-Tetradecamethylheptasiloxane |
|---|---|
| PubChem CID | 6329088 |
| Molecular Formula | C14H42O6Si7 |
| Molecular Weight | 503.09 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | — |
| SMILES | C[Si](C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)C |
| InChI | InChI=1S/C14H42O6Si7/c1-21(2)15-23(5,6)17-25(9,10)19-27(13,14)20-26(11,12)18-24(7,8)16-22(3)4/h1-14H3 |
| InChIKey | JJIDUNHDYJESJA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.09 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|