C6H18O2Si3 — CID 6327152
1,1,3,3,5,5-Hexamethyltrisiloxane (PubChem CID 6327152) has the molecular formula C6H18O2Si3 and a molecular weight of 206.47 g/mol.
| Compound Name | 1,1,3,3,5,5-Hexamethyltrisiloxane |
|---|---|
| PubChem CID | 6327152 |
| Molecular Formula | C6H18O2Si3 |
| Molecular Weight | 206.47 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | — |
| SMILES | C[Si](C)O[Si](C)(C)O[Si](C)C |
| InChI | InChI=1S/C6H18O2Si3/c1-9(2)7-11(5,6)8-10(3)4/h1-6H3 |
| InChIKey | YTEISYFNYGDBRV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|