C11H31O3Si4 — CID 19832548
CID 19832548 (PubChem CID 19832548) has the molecular formula C11H31O3Si4 and a molecular weight of 323.71 g/mol.
| Compound Name | CID 19832548 |
|---|---|
| PubChem CID | 19832548 |
| Molecular Formula | C11H31O3Si4 |
| Molecular Weight | 323.71 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | — |
| SMILES | CCC[Si](C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H31O3Si4/c1-10-11-15(2)12-17(6,7)14-18(8,9)13-16(3,4)5/h10-11H2,1-9H3 |
| InChIKey | BGBGGSLKOVPQAP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|