C10H29O3Si4 — CID 20771109
CID 20771109 (PubChem CID 20771109) has the molecular formula C10H29O3Si4 and a molecular weight of 309.68 g/mol.
| Compound Name | CID 20771109 |
|---|---|
| PubChem CID | 20771109 |
| Molecular Formula | C10H29O3Si4 |
| Molecular Weight | 309.68 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | — |
| SMILES | CC[Si](O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H29O3Si4/c1-10-14(11-15(2,3)4)12-17(8,9)13-16(5,6)7/h10H2,1-9H3 |
| InChIKey | CUBPNRDREWWRBB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.68 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|