C10H26O2Si2 — CID 169004252
dimethyl-pentan-3-yloxy-trimethylsilyloxysilane (PubChem CID 169004252) has the molecular formula C10H26O2Si2 and a molecular weight of 234.49 g/mol. Its IUPAC name is dimethyl-pentan-3-yloxy-trimethylsilyloxysilane.
| Compound Name | dimethyl-pentan-3-yloxy-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 169004252 |
| Molecular Formula | C10H26O2Si2 |
| Molecular Weight | 234.49 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | dimethyl-pentan-3-yloxy-trimethylsilyloxysilane |
| SMILES | CCC(CC)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C10H26O2Si2/c1-8-10(9-2)11-14(6,7)12-13(3,4)5/h10H,8-9H2,1-7H3 |
| InChIKey | IDPZYZLAFKAAMM-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|