C11H31NO2Si3 — CID 140869302
N-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butan-2-amine (PubChem CID 140869302) has the molecular formula C11H31NO2Si3 and a molecular weight of 293.63 g/mol. Its IUPAC name is N-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butan-2-amine.
| Compound Name | N-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butan-2-amine |
|---|---|
| PubChem CID | 140869302 |
| Molecular Formula | C11H31NO2Si3 |
| Molecular Weight | 293.63 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | N-[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]butan-2-amine |
| SMILES | CCC(C)N[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H31NO2Si3/c1-10-11(2)12-16(6,7)14-17(8,9)13-15(3,4)5/h11-12H,10H2,1-9H3 |
| InChIKey | JKKYAIMYVDVMGP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.63 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|