C10H29NO2Si3 — CID 154006218
N-[[dimethylsilyloxy(dimethyl)silyl]oxy-dimethylsilyl]butan-2-amine (PubChem CID 154006218) has the molecular formula C10H29NO2Si3 and a molecular weight of 279.61 g/mol. Its IUPAC name is N-[[dimethylsilyloxy(dimethyl)silyl]oxy-dimethylsilyl]butan-2-amine.
| Compound Name | N-[[dimethylsilyloxy(dimethyl)silyl]oxy-dimethylsilyl]butan-2-amine |
|---|---|
| PubChem CID | 154006218 |
| Molecular Formula | C10H29NO2Si3 |
| Molecular Weight | 279.61 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[[dimethylsilyloxy(dimethyl)silyl]oxy-dimethylsilyl]butan-2-amine |
| SMILES | CCC(C)N[Si](C)(C)O[Si](C)(C)O[SiH](C)C |
| InChI | InChI=1S/C10H29NO2Si3/c1-9-10(2)11-15(5,6)13-16(7,8)12-14(3)4/h10-11,14H,9H2,1-8H3 |
| InChIKey | LZOXWXJZFVOTGA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.61 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|