C22H66O9Si10 — CID 160789743
tris[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy]-methylsilane (PubChem CID 160789743) has the molecular formula C22H66O9Si10 and a molecular weight of 755.62 g/mol. Its IUPAC name is tris[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy]-methylsilane.
| Compound Name | tris[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy]-methylsilane |
|---|---|
| PubChem CID | 160789743 |
| Molecular Formula | C22H66O9Si10 |
| Molecular Weight | 755.62 g/mol |
| Exact Mass | 754.24 |
| IUPAC Name | tris[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy]-methylsilane |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C22H66O9Si10/c1-32(2,3)23-35(10,11)26-38(16,17)29-41(22,30-39(18,19)27-36(12,13)24-33(4,5)6)31-40(20,21)28-37(14,15)25-34(7,8)9/h1-22H3 |
| InChIKey | IORANXWMJJROCV-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.62 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|