C16H45O4Si7 — CID 59938623
CID 59938623 (PubChem CID 59938623) has the molecular formula C16H45O4Si7 and a molecular weight of 498.13 g/mol.
| Compound Name | CID 59938623 |
|---|---|
| PubChem CID | 59938623 |
| Molecular Formula | C16H45O4Si7 |
| Molecular Weight | 498.13 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | — |
| SMILES | C[Si]C[Si](C)(C)O[Si](C)CC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H45O4Si7/c1-21-16-25(9,10)17-22(2)14-15-27(13,19-24(6,7)8)20-26(11,12)18-23(3,4)5/h14-16H2,1-13H3 |
| InChIKey | RFPRFTAUMXPRGJ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.13 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|