C16H48O9Si10 — CID 22670809
CID 22670809 (PubChem CID 22670809) has the molecular formula C16H48O9Si10 and a molecular weight of 665.41 g/mol.
| Compound Name | CID 22670809 |
|---|---|
| PubChem CID | 22670809 |
| Molecular Formula | C16H48O9Si10 |
| Molecular Weight | 665.41 g/mol |
| Exact Mass | 664.10 |
| IUPAC Name | — |
| SMILES | C[Si](O[Si]O[Si])O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H48O9Si10/c1-28(18-27-17-26)19-30(5,6)21-32(9,10)23-34(13,14)25-35(15,16)24-33(11,12)22-31(7,8)20-29(2,3)4/h1-16H3 |
| InChIKey | KLRTXNDPBPSZJW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|