C11H30N2O3Si3 — CID 155623519
2-N,2-N,4-N,4-N-tetraethyl-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane-2,4-diamine (PubChem CID 155623519) has the molecular formula C11H30N2O3Si3 and a molecular weight of 322.63 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N-tetraethyl-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane-2,4-diamine.
| Compound Name | 2-N,2-N,4-N,4-N-tetraethyl-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane-2,4-diamine |
|---|---|
| PubChem CID | 155623519 |
| Molecular Formula | C11H30N2O3Si3 |
| Molecular Weight | 322.63 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2-N,2-N,4-N,4-N-tetraethyl-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinane-2,4-diamine |
| SMILES | CCN(CC)[Si]1(C)O[SiH](C)O[Si](C)(N(CC)CC)O1 |
| InChI | InChI=1S/C11H30N2O3Si3/c1-8-12(9-2)18(6)14-17(5)15-19(7,16-18)13(10-3)11-4/h17H,8-11H2,1-7H3 |
| InChIKey | CPGCNOKSZPCRQN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.63 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|