C4H15ClO4Si4 — CID 154027680
2-chloro-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 154027680) has the molecular formula C4H15ClO4Si4 and a molecular weight of 274.96 g/mol. Its IUPAC name is 2-chloro-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-chloro-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 154027680 |
| Molecular Formula | C4H15ClO4Si4 |
| Molecular Weight | 274.96 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 2-chloro-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[SiH]1O[SiH](C)O[Si](C)(Cl)O[SiH](C)O1 |
| InChI | InChI=1S/C4H15ClO4Si4/c1-10-6-11(2)8-13(4,5)9-12(3)7-10/h10-12H,1-4H3 |
| InChIKey | LOSOZOZCSVCAIF-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.96 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|